C15H21NO2 — CID 53306953
(3aS,4S,6S,6aR)-2,2,6-trimethyl-4-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 53306953) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (3aS,4S,6S,6aR)-2,2,6-trimethyl-4-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aS,4S,6S,6aR)-2,2,6-trimethyl-4-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 53306953 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (3aS,4S,6S,6aR)-2,2,6-trimethyl-4-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | Cc1ccc([C@@H]2N[C@@H](C)[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C15H21NO2/c1-9-5-7-11(8-6-9)12-14-13(10(2)16-12)17-15(3,4)18-14/h5-8,10,12-14,16H,1-4H3/t10-,12-,13+,14-/m0/s1 |
| InChIKey | LCKMFDOLEXEOOD-DEQVHRJGSA-N |
| XLogP | 2.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |