C24H31N3OSi — CID 102068830
2-ethyl-3-[(2S,3S)-2-phenyl-3-triethylsilylaziridin-1-yl]quinazolin-4-one (PubChem CID 102068830) has the molecular formula C24H31N3OSi and a molecular weight of 405.62 g/mol. Its IUPAC name is 2-ethyl-3-[(2S,3S)-2-phenyl-3-triethylsilylaziridin-1-yl]quinazolin-4-one.
| Compound Name | 2-ethyl-3-[(2S,3S)-2-phenyl-3-triethylsilylaziridin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 102068830 |
| Molecular Formula | C24H31N3OSi |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 2-ethyl-3-[(2S,3S)-2-phenyl-3-triethylsilylaziridin-1-yl]quinazolin-4-one |
| SMILES | CCc1nc2ccccc2c(=O)n1N1[C@@H](c2ccccc2)[C@@H]1[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H31N3OSi/c1-5-21-25-20-17-13-12-16-19(20)23(28)26(21)27-22(18-14-10-9-11-15-18)24(27)29(6-2,7-3)8-4/h9-17,22,24H,5-8H2,1-4H3/t22-,24-,27?/m0/s1 |
| InChIKey | DDRDLAKATORUGX-ZRUXRWDSSA-N |
| XLogP | 5.07 |
| TPSA | 37.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|