C18H17FN4O2 — CID 70838560
1-(2-ethyl-4-oxoquinazolin-3-yl)-3-[(4-fluorophenyl)methyl]urea (PubChem CID 70838560) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-(2-ethyl-4-oxoquinazolin-3-yl)-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-(2-ethyl-4-oxoquinazolin-3-yl)-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 70838560 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-(2-ethyl-4-oxoquinazolin-3-yl)-3-[(4-fluorophenyl)methyl]urea |
| SMILES | CCc1nc2ccccc2c(=O)n1NC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN4O2/c1-2-16-21-15-6-4-3-5-14(15)17(24)23(16)22-18(25)20-11-12-7-9-13(19)10-8-12/h3-10H,2,11H2,1H3,(H2,20,22,25) |
| InChIKey | FGDSPVAHENZPBE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |