C21H22O8 — CID 102069347
ethyl (1S,4R,6R)-4-benzoyloxy-6-hydroxy-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-3-methylcyclohex-2-ene-1-carboxylate (PubChem CID 102069347) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is ethyl (1S,4R,6R)-4-benzoyloxy-6-hydroxy-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-3-methylcyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl (1S,4R,6R)-4-benzoyloxy-6-hydroxy-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-3-methylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 102069347 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | ethyl (1S,4R,6R)-4-benzoyloxy-6-hydroxy-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-3-methylcyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C=C(C)[C@H](OC(=O)c2ccccc2)C[C@]1(O)C1=CC(O)OC1=O |
| InChI | InChI=1S/C21H22O8/c1-3-27-19(24)14-9-12(2)16(28-18(23)13-7-5-4-6-8-13)11-21(14,26)15-10-17(22)29-20(15)25/h4-10,14,16-17,22,26H,3,11H2,1-2H3/t14-,16-,17?,21-/m1/s1 |
| InChIKey | YQWDIOOLIOVXJT-IIVKEMRBSA-N |
| XLogP | 1.27 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|