C11H17NO3 — CID 102070349
3-[(2R)-2-propylpent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 102070349) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[(2R)-2-propylpent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2R)-2-propylpent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102070349 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-[(2R)-2-propylpent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@@H](CCC)C(=O)N1CCOC1=O |
| InChI | InChI=1S/C11H17NO3/c1-3-5-9(6-4-2)10(13)12-7-8-15-11(12)14/h3,9H,1,4-8H2,2H3/t9-/m0/s1 |
| InChIKey | NQLSYOQHJHHSQH-VIFPVBQESA-N |
| XLogP | 1.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|