C28H34N2O4S — CID 102070730
[(1S,15R,17S,18S)-17-ethyl-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-1-yl]methyl 4-methylbenzenesulfonate (PubChem CID 102070730) has the molecular formula C28H34N2O4S and a molecular weight of 494.66 g/mol. Its IUPAC name is [(1S,15R,17S,18S)-17-ethyl-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-1-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,15R,17S,18S)-17-ethyl-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102070730 |
| Molecular Formula | C28H34N2O4S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | [(1S,15R,17S,18S)-17-ethyl-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-1-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CC[C@H]1C[C@H]2CN3CCc4c([nH]c5ccc(OC)cc45)[C@](COS(=O)(=O)c4ccc(C)cc4)(C2)[C@H]13 |
| InChI | InChI=1S/C28H34N2O4S/c1-4-20-13-19-15-28(17-34-35(31,32)22-8-5-18(2)6-9-22)26-23(11-12-30(16-19)27(20)28)24-14-21(33-3)7-10-25(24)29-26/h5-10,14,19-20,27,29H,4,11-13,15-17H2,1-3H3/t19-,20+,27+,28-/m1/s1 |
| InChIKey | VSIZYZPLOVKRPM-HFDGUFSPSA-N |
| XLogP | 4.80 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|