C20H23LiN2O3 — CID 140621004
lithium (1S,15S,17S)-17-ethyl-7-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-1-carboxylate (PubChem CID 140621004) has the molecular formula C20H23LiN2O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is lithium (1S,15S,17S)-17-ethyl-7-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-1-carboxylate.
| Compound Name | lithium (1S,15S,17S)-17-ethyl-7-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 140621004 |
| Molecular Formula | C20H23LiN2O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | lithium (1S,15S,17S)-17-ethyl-7-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-1-carboxylate |
| SMILES | CC[C@H]1C[C@@H]2CN3CCc4c([nH]c5ccc(O)cc45)[C@](C(=O)[O-])(C2)C13.[Li+] |
| InChI | InChI=1S/C20H24N2O3.Li/c1-2-12-7-11-9-20(19(24)25)17-14(5-6-22(10-11)18(12)20)15-8-13(23)3-4-16(15)21-17;/h3-4,8,11-12,18,21,23H,2,5-7,9-10H2,1H3,(H,24,25);/q;+1/p-1/t11-,12-,18?,20+;/m0./s1 |
| InChIKey | RQOUJYIHYHOQNH-UIGSZBOZSA-M |
| XLogP | -1.46 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |