C16H22O2S — CID 102071487
(2R,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran (PubChem CID 102071487) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is (2R,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 102071487 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2R,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran |
| SMILES | CCCC[C@H]1OCC=C[C@H]1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O2S/c1-3-4-6-15-16(7-5-12-18-15)19(17)14-10-8-13(2)9-11-14/h5,7-11,15-16H,3-4,6,12H2,1-2H3/t15-,16-,19?/m1/s1 |
| InChIKey | UPVFIQZUTMASLK-QNRNLVPOSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|