C14H17NO4 — CID 102072541
1,7-dimethoxy-3-prop-2-enyl-1-azaspiro[4.5]deca-6,9-diene-2,8-dione (PubChem CID 102072541) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 1,7-dimethoxy-3-prop-2-enyl-1-azaspiro[4.5]deca-6,9-diene-2,8-dione.
| Compound Name | 1,7-dimethoxy-3-prop-2-enyl-1-azaspiro[4.5]deca-6,9-diene-2,8-dione |
|---|---|
| PubChem CID | 102072541 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1,7-dimethoxy-3-prop-2-enyl-1-azaspiro[4.5]deca-6,9-diene-2,8-dione |
| SMILES | C=CCC1CC2(C=CC(=O)C(OC)=C2)N(OC)C1=O |
| InChI | InChI=1S/C14H17NO4/c1-4-5-10-8-14(15(19-3)13(10)17)7-6-11(16)12(9-14)18-2/h4,6-7,9-10H,1,5,8H2,2-3H3 |
| InChIKey | GMXBILXOEIJDGD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|