C15H19NO5 — CID 102072542
1,7,9-trimethoxy-3-prop-2-enyl-1-azaspiro[4.5]deca-6,9-diene-2,8-dione (PubChem CID 102072542) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1,7,9-trimethoxy-3-prop-2-enyl-1-azaspiro[4.5]deca-6,9-diene-2,8-dione.
| Compound Name | 1,7,9-trimethoxy-3-prop-2-enyl-1-azaspiro[4.5]deca-6,9-diene-2,8-dione |
|---|---|
| PubChem CID | 102072542 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 1,7,9-trimethoxy-3-prop-2-enyl-1-azaspiro[4.5]deca-6,9-diene-2,8-dione |
| SMILES | C=CCC1CC2(C=C(OC)C(=O)C(OC)=C2)N(OC)C1=O |
| InChI | InChI=1S/C15H19NO5/c1-5-6-10-7-15(16(21-4)14(10)18)8-11(19-2)13(17)12(9-15)20-3/h5,8-10H,1,6-7H2,2-4H3 |
| InChIKey | OLIMNJYGLUILER-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|