C7H11NO3 — CID 102072752
(4R,5R)-4-(hydroxymethyl)-5-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 102072752) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is (4R,5R)-4-(hydroxymethyl)-5-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-(hydroxymethyl)-5-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102072752 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (4R,5R)-4-(hydroxymethyl)-5-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H]1OC(=O)N[C@@H]1CO |
| InChI | InChI=1S/C7H11NO3/c1-2-3-6-5(4-9)8-7(10)11-6/h2,5-6,9H,1,3-4H2,(H,8,10)/t5-,6-/m1/s1 |
| InChIKey | XJVCLTDQFGGNPV-PHDIDXHHSA-N |
| XLogP | 0.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|