C17H21N3O5 — CID 102073088
ethyl (2S)-1-[(2R)-7-amino-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 102073088) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is ethyl (2S)-1-[(2R)-7-amino-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[(2R)-7-amino-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102073088 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl (2S)-1-[(2R)-7-amino-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN1C(=O)[C@]1(C)Oc2cc(N)ccc2NC1=O |
| InChI | InChI=1S/C17H21N3O5/c1-3-24-14(21)12-5-4-8-20(12)16(23)17(2)15(22)19-11-7-6-10(18)9-13(11)25-17/h6-7,9,12H,3-5,8,18H2,1-2H3,(H,19,22)/t12-,17+/m0/s1 |
| InChIKey | SIRDCENEEMWOQF-YVEFUNNKSA-N |
| XLogP | 0.91 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|