C18H22N2O5 — CID 75795787
ethyl 1-(2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl)piperidine-2-carboxylate (PubChem CID 75795787) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is ethyl 1-(2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl)piperidine-2-carboxylate.
| Compound Name | ethyl 1-(2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 75795787 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl 1-(2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl)piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)C1(C)Oc2ccccc2NC1=O |
| InChI | InChI=1S/C18H22N2O5/c1-3-24-15(21)13-9-6-7-11-20(13)17(23)18(2)16(22)19-12-8-4-5-10-14(12)25-18/h4-5,8,10,13H,3,6-7,9,11H2,1-2H3,(H,19,22) |
| InChIKey | VFRYDMBEMBDRMC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|