C22H40O2Si — CID 102073169
tert-butyl-dimethyl-[(E)-3-[(1S,2S)-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexyl]but-2-enoxy]silane (PubChem CID 102073169) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-3-[(1S,2S)-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexyl]but-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-3-[(1S,2S)-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexyl]but-2-enoxy]silane |
|---|---|
| PubChem CID | 102073169 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-3-[(1S,2S)-1-prop-2-enoxy-2-prop-1-en-2-ylcyclohexyl]but-2-enoxy]silane |
| SMILES | C=CCO[C@@]1(/C(C)=C/CO[Si](C)(C)C(C)(C)C)CCCC[C@H]1C(=C)C |
| InChI | InChI=1S/C22H40O2Si/c1-10-16-23-22(15-12-11-13-20(22)18(2)3)19(4)14-17-24-25(8,9)21(5,6)7/h10,14,20H,1-2,11-13,15-17H2,3-9H3/b19-14+/t20-,22+/m0/s1 |
| InChIKey | PMSAYMACUGLGHT-YAQOUWLDSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|