C15H18O4 — CID 102073822
ethyl 4-(2,3-dimethoxyphenyl)-2-methylbuta-2,3-dienoate (PubChem CID 102073822) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is ethyl 4-(2,3-dimethoxyphenyl)-2-methylbuta-2,3-dienoate.
| Compound Name | ethyl 4-(2,3-dimethoxyphenyl)-2-methylbuta-2,3-dienoate |
|---|---|
| PubChem CID | 102073822 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl 4-(2,3-dimethoxyphenyl)-2-methylbuta-2,3-dienoate |
| SMILES | CCOC(=O)C(C)=C=Cc1cccc(OC)c1OC |
| InChI | InChI=1S/C15H18O4/c1-5-19-15(16)11(2)9-10-12-7-6-8-13(17-3)14(12)18-4/h6-8,10H,5H2,1-4H3 |
| InChIKey | VAMJWAUMZOCGKC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|