C20H32O4 — CID 102074043
ditert-butyl 2-(1-propa-1,2-dienylcyclohexyl)propanedioate (PubChem CID 102074043) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is ditert-butyl 2-(1-propa-1,2-dienylcyclohexyl)propanedioate.
| Compound Name | ditert-butyl 2-(1-propa-1,2-dienylcyclohexyl)propanedioate |
|---|---|
| PubChem CID | 102074043 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | ditert-butyl 2-(1-propa-1,2-dienylcyclohexyl)propanedioate |
| SMILES | C=C=CC1(C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C20H32O4/c1-8-12-20(13-10-9-11-14-20)15(16(21)23-18(2,3)4)17(22)24-19(5,6)7/h12,15H,1,9-11,13-14H2,2-7H3 |
| InChIKey | STUXCBPUFRPIDJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|