C14H22N2O4 — CID 118486072
2-(1-ethenylcyclopentyl)-2-[(2-methylpropan-2-yl)oxycarbonyldiazenyl]acetic acid (PubChem CID 118486072) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(1-ethenylcyclopentyl)-2-[(2-methylpropan-2-yl)oxycarbonyldiazenyl]acetic acid.
| Compound Name | 2-(1-ethenylcyclopentyl)-2-[(2-methylpropan-2-yl)oxycarbonyldiazenyl]acetic acid |
|---|---|
| PubChem CID | 118486072 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-(1-ethenylcyclopentyl)-2-[(2-methylpropan-2-yl)oxycarbonyldiazenyl]acetic acid |
| SMILES | C=CC1(C(/N=N/C(=O)OC(C)(C)C)C(=O)O)CCCC1 |
| InChI | InChI=1S/C14H22N2O4/c1-5-14(8-6-7-9-14)10(11(17)18)15-16-12(19)20-13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,17,18)/b16-15+ |
| InChIKey | HEQNZXHEUUXAQM-FOCLMDBBSA-N |
| XLogP | 3.57 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|