C34H23NO3 — CID 102074899
2-[2-[2-methoxy-4-[2-[2-methoxy-4-[2-(2-methoxyphenyl)ethynyl]phenyl]ethynyl]phenyl]ethynyl]benzonitrile (PubChem CID 102074899) has the molecular formula C34H23NO3 and a molecular weight of 493.56 g/mol. Its IUPAC name is 2-[2-[2-methoxy-4-[2-[2-methoxy-4-[2-(2-methoxyphenyl)ethynyl]phenyl]ethynyl]phenyl]ethynyl]benzonitrile.
| Compound Name | 2-[2-[2-methoxy-4-[2-[2-methoxy-4-[2-(2-methoxyphenyl)ethynyl]phenyl]ethynyl]phenyl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 102074899 |
| Molecular Formula | C34H23NO3 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 2-[2-[2-methoxy-4-[2-[2-methoxy-4-[2-(2-methoxyphenyl)ethynyl]phenyl]ethynyl]phenyl]ethynyl]benzonitrile |
| SMILES | COc1ccccc1C#Cc1ccc(C#Cc2ccc(C#Cc3ccccc3C#N)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C34H23NO3/c1-36-32-11-7-6-9-28(32)16-12-25-13-17-29(33(22-25)37-2)18-14-26-15-19-30(34(23-26)38-3)21-20-27-8-4-5-10-31(27)24-35/h4-11,13,15,17,19,22-23H,1-3H3 |
| InChIKey | XPQJWZJBMFOZCV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|