C13H17F3SSi — CID 102074971
trimethyl-[(E)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]silane (PubChem CID 102074971) has the molecular formula C13H17F3SSi and a molecular weight of 290.43 g/mol. Its IUPAC name is trimethyl-[(E)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]silane.
| Compound Name | trimethyl-[(E)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]silane |
|---|---|
| PubChem CID | 102074971 |
| Molecular Formula | C13H17F3SSi |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | trimethyl-[(E)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]silane |
| SMILES | Cc1ccc(S/C(=C/C(F)(F)F)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C13H17F3SSi/c1-10-5-7-11(8-6-10)17-12(18(2,3)4)9-13(14,15)16/h5-9H,1-4H3/b12-9- |
| InChIKey | GPWOZVUOQRITDV-XFXZXTDPSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|