C24H31N3O7 — CID 102077596
diethyl 2-[cyclohexyl-(2-ethoxy-2-oxoacetyl)amino]-4H-pyrido[1,2-a]pyrimidine-3,4-dicarboxylate (PubChem CID 102077596) has the molecular formula C24H31N3O7 and a molecular weight of 473.53 g/mol. Its IUPAC name is diethyl 2-[cyclohexyl-(2-ethoxy-2-oxoacetyl)amino]-4H-pyrido[1,2-a]pyrimidine-3,4-dicarboxylate.
| Compound Name | diethyl 2-[cyclohexyl-(2-ethoxy-2-oxoacetyl)amino]-4H-pyrido[1,2-a]pyrimidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102077596 |
| Molecular Formula | C24H31N3O7 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | diethyl 2-[cyclohexyl-(2-ethoxy-2-oxoacetyl)amino]-4H-pyrido[1,2-a]pyrimidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)C(=O)N(C1=C(C(=O)OCC)C(C(=O)OCC)N2C=CC=CC2=N1)C1CCCCC1 |
| InChI | InChI=1S/C24H31N3O7/c1-4-32-22(29)18-19(23(30)33-5-2)26-15-11-10-14-17(26)25-20(18)27(16-12-8-7-9-13-16)21(28)24(31)34-6-3/h10-11,14-16,19H,4-9,12-13H2,1-3H3 |
| InChIKey | HQRRADKZPOVTJS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 114.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|