C15H22O2 — CID 102078108
(5aS,9aS,10aR)-6,6,9a-trimethyl-1,3,5,5a,9,10a-hexahydrofuro[3,4-b][1]benzoxepine (PubChem CID 102078108) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (5aS,9aS,10aR)-6,6,9a-trimethyl-1,3,5,5a,9,10a-hexahydrofuro[3,4-b][1]benzoxepine.
| Compound Name | (5aS,9aS,10aR)-6,6,9a-trimethyl-1,3,5,5a,9,10a-hexahydrofuro[3,4-b][1]benzoxepine |
|---|---|
| PubChem CID | 102078108 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (5aS,9aS,10aR)-6,6,9a-trimethyl-1,3,5,5a,9,10a-hexahydrofuro[3,4-b][1]benzoxepine |
| SMILES | CC1(C)C=CC[C@]2(C)O[C@H]3COCC3=CC[C@@H]12 |
| InChI | InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)13(14)6-5-11-9-16-10-12(11)17-15/h4-5,7,12-13H,6,8-10H2,1-3H3/t12-,13-,15-/m0/s1 |
| InChIKey | VSXJRQBXANALRR-YDHLFZDLSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|