About 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate
6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate (PubChem CID 102078601) has the molecular formula C22H24Cl2O4
and a molecular weight of 423.34 g/mol. Its IUPAC name is 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate.
Molecular Properties
| Compound Name | 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate |
| PubChem CID | 102078601 |
| Molecular Formula | C22H24Cl2O4 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate |
| SMILES | O=C(OCCCCCCOC(=O)c1ccc(CCl)cc1)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C22H24Cl2O4/c23-15-17-5-9-19(10-6-17)21(25)27-13-3-1-2-4-14-28-22(26)20-11-7-18(16-24)8-12-20/h5-12H,1-4,13-16H2 |
| InChIKey | ABBQPCMGENJVTR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate?
The IUPAC name of 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate (CID 102078601) is 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate.
What is the SMILES notation for 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate?
The canonical SMILES for 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate is O=C(OCCCCCCOC(=O)c1ccc(CCl)cc1)c1ccc(CCl)cc1.
What is the InChIKey of 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate?
The InChIKey is ABBQPCMGENJVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24Cl2O4/c23-15-17-5-9-19(10-6-17)21(25)27-13-3-1-2-4-14-28-22(26)20-11-7-18(16-24)8-12-20/h5-12H,1-4,13-16H2.
What are the key properties of 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate?
6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate has a molecular weight of 423.34 g/mol, XLogP of 5.74, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(chloromethyl)benzoyl]oxyhexyl 4-(chloromethyl)benzoate is sourced from PubChem (CID 102078601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).