About 2-ethynylbenzotriazole
2-ethynylbenzotriazole (PubChem CID 102079904) has the molecular formula C8H5N3
and a molecular weight of 143.15 g/mol. Its IUPAC name is 2-ethynylbenzotriazole.
Molecular Properties
| Compound Name | 2-ethynylbenzotriazole |
| PubChem CID | 102079904 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 2-ethynylbenzotriazole |
| SMILES | C#Cn1nc2ccccc2n1 |
| InChI | InChI=1S/C8H5N3/c1-2-11-9-7-5-3-4-6-8(7)10-11/h1,3-6H |
| InChIKey | DBAXHNPFCQHOSR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynylbenzotriazole?
The IUPAC name of 2-ethynylbenzotriazole (CID 102079904) is 2-ethynylbenzotriazole.
What is the SMILES notation for 2-ethynylbenzotriazole?
The canonical SMILES for 2-ethynylbenzotriazole is C#Cn1nc2ccccc2n1.
What is the InChIKey of 2-ethynylbenzotriazole?
The InChIKey is DBAXHNPFCQHOSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3/c1-2-11-9-7-5-3-4-6-8(7)10-11/h1,3-6H.
What are the key properties of 2-ethynylbenzotriazole?
2-ethynylbenzotriazole has a molecular weight of 143.15 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynylbenzotriazole is sourced from PubChem (CID 102079904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).