About benzotriazol-2-ylalumane
benzotriazol-2-ylalumane (PubChem CID 154405892) has the molecular formula C6H6AlN3
and a molecular weight of 147.12 g/mol. Its IUPAC name is benzotriazol-2-ylalumane.
Molecular Properties
| Compound Name | benzotriazol-2-ylalumane |
| PubChem CID | 154405892 |
| Molecular Formula | C6H6AlN3 |
| Molecular Weight | 147.12 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | benzotriazol-2-ylalumane |
| SMILES | [AlH2]n1nc2ccccc2n1 |
| InChI | InChI=1S/C6H4N3.Al.2H/c1-2-4-6-5(3-1)7-9-8-6;;;/h1-4H;;;/q-1;+1;; |
| InChIKey | UIUVQWPOTFHLAJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.12 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzotriazol-2-ylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-2-ylalumane?
The IUPAC name of benzotriazol-2-ylalumane (CID 154405892) is benzotriazol-2-ylalumane.
What is the SMILES notation for benzotriazol-2-ylalumane?
The canonical SMILES for benzotriazol-2-ylalumane is [AlH2]n1nc2ccccc2n1.
What is the InChIKey of benzotriazol-2-ylalumane?
The InChIKey is UIUVQWPOTFHLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3.Al.2H/c1-2-4-6-5(3-1)7-9-8-6;;;/h1-4H;;;/q-1;+1;;.
What are the key properties of benzotriazol-2-ylalumane?
benzotriazol-2-ylalumane has a molecular weight of 147.12 g/mol, XLogP of -0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-2-ylalumane is sourced from PubChem (CID 154405892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).