C15H24O3 — CID 102082076
(1R,5S)-4-(methoxymethoxy)-1-(2-methylpropyl)spiro[4.4]non-3-en-9-one (PubChem CID 102082076) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,5S)-4-(methoxymethoxy)-1-(2-methylpropyl)spiro[4.4]non-3-en-9-one.
| Compound Name | (1R,5S)-4-(methoxymethoxy)-1-(2-methylpropyl)spiro[4.4]non-3-en-9-one |
|---|---|
| PubChem CID | 102082076 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,5S)-4-(methoxymethoxy)-1-(2-methylpropyl)spiro[4.4]non-3-en-9-one |
| SMILES | COCOC1=CC[C@@H](CC(C)C)[C@@]12CCCC2=O |
| InChI | InChI=1S/C15H24O3/c1-11(2)9-12-6-7-14(18-10-17-3)15(12)8-4-5-13(15)16/h7,11-12H,4-6,8-10H2,1-3H3/t12-,15+/m0/s1 |
| InChIKey | VQDKAISGAKRXFQ-SWLSCSKDSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|