C31H29OPS — CID 102083814
(E)-2-diphenylphosphinothioyl-1,3-diphenylhept-2-en-1-one (PubChem CID 102083814) has the molecular formula C31H29OPS and a molecular weight of 480.61 g/mol. Its IUPAC name is (E)-2-diphenylphosphinothioyl-1,3-diphenylhept-2-en-1-one.
| Compound Name | (E)-2-diphenylphosphinothioyl-1,3-diphenylhept-2-en-1-one |
|---|---|
| PubChem CID | 102083814 |
| Molecular Formula | C31H29OPS |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | (E)-2-diphenylphosphinothioyl-1,3-diphenylhept-2-en-1-one |
| SMILES | CCCC/C(=C(/C(=O)c1ccccc1)P(=S)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29OPS/c1-2-3-24-29(25-16-8-4-9-17-25)31(30(32)26-18-10-5-11-19-26)33(34,27-20-12-6-13-21-27)28-22-14-7-15-23-28/h4-23H,2-3,24H2,1H3/b31-29+ |
| InChIKey | MNOLMJITLCKQIW-OWWNRXNESA-N |
| XLogP | 7.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|