C18H19F2PS — CID 11099759
1,1-difluorohex-1-en-2-yl-diphenyl-sulfanylidene-lambda5-phosphane (PubChem CID 11099759) has the molecular formula C18H19F2PS and a molecular weight of 336.39 g/mol. Its IUPAC name is 1,1-difluorohex-1-en-2-yl-diphenyl-sulfanylidene-lambda5-phosphane.
| Compound Name | 1,1-difluorohex-1-en-2-yl-diphenyl-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 11099759 |
| Molecular Formula | C18H19F2PS |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1,1-difluorohex-1-en-2-yl-diphenyl-sulfanylidene-lambda5-phosphane |
| SMILES | CCCCC(=C(F)F)P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19F2PS/c1-2-3-14-17(18(19)20)21(22,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3 |
| InChIKey | SOCPSFCPSHDCNU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|