C29H28P2S2 — CID 102184006
[(Z)-1-diphenylphosphinothioylpent-1-en-2-yl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 102184006) has the molecular formula C29H28P2S2 and a molecular weight of 502.63 g/mol. Its IUPAC name is [(Z)-1-diphenylphosphinothioylpent-1-en-2-yl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [(Z)-1-diphenylphosphinothioylpent-1-en-2-yl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 102184006 |
| Molecular Formula | C29H28P2S2 |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | [(Z)-1-diphenylphosphinothioylpent-1-en-2-yl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | CCC/C(=C/P(=S)(c1ccccc1)c1ccccc1)P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28P2S2/c1-2-15-29(31(33,27-20-11-5-12-21-27)28-22-13-6-14-23-28)24-30(32,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h3-14,16-24H,2,15H2,1H3/b29-24- |
| InChIKey | NKFWCVSXDOHEAE-OLFWJLLRSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|