C21H25PS — CID 102083818
[(4E)-nona-1,4-dien-4-yl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 102083818) has the molecular formula C21H25PS and a molecular weight of 340.47 g/mol. Its IUPAC name is [(4E)-nona-1,4-dien-4-yl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [(4E)-nona-1,4-dien-4-yl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 102083818 |
| Molecular Formula | C21H25PS |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [(4E)-nona-1,4-dien-4-yl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | C=CC/C(=C\CCCC)P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25PS/c1-3-5-8-14-19(13-4-2)22(23,20-15-9-6-10-16-20)21-17-11-7-12-18-21/h4,6-7,9-12,14-18H,2-3,5,8,13H2,1H3/b19-14+ |
| InChIKey | JBUHBEXKPTZDRI-XMHGGMMESA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|