C18H19PS — CID 12608266
[(1E)-4-methylpenta-1,3-dienyl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 12608266) has the molecular formula C18H19PS and a molecular weight of 298.39 g/mol. Its IUPAC name is [(1E)-4-methylpenta-1,3-dienyl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [(1E)-4-methylpenta-1,3-dienyl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 12608266 |
| Molecular Formula | C18H19PS |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | [(1E)-4-methylpenta-1,3-dienyl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)=C/C=C/P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19PS/c1-16(2)10-9-15-19(20,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-15H,1-2H3/b15-9+ |
| InChIKey | BLLPQFMAVZLCSY-OQLLNIDSSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|