C27H26N2O5 — CID 102084590
ethyl (2S,3R)-3-(4-methylphenyl)-2-nitro-3-(5-phenylmethoxy-1H-indol-3-yl)propanoate (PubChem CID 102084590) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is ethyl (2S,3R)-3-(4-methylphenyl)-2-nitro-3-(5-phenylmethoxy-1H-indol-3-yl)propanoate.
| Compound Name | ethyl (2S,3R)-3-(4-methylphenyl)-2-nitro-3-(5-phenylmethoxy-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 102084590 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | ethyl (2S,3R)-3-(4-methylphenyl)-2-nitro-3-(5-phenylmethoxy-1H-indol-3-yl)propanoate |
| SMILES | CCOC(=O)[C@H]([C@H](c1ccc(C)cc1)c1c[nH]c2ccc(OCc3ccccc3)cc12)[N+](=O)[O-] |
| InChI | InChI=1S/C27H26N2O5/c1-3-33-27(30)26(29(31)32)25(20-11-9-18(2)10-12-20)23-16-28-24-14-13-21(15-22(23)24)34-17-19-7-5-4-6-8-19/h4-16,25-26,28H,3,17H2,1-2H3/t25-,26+/m1/s1 |
| InChIKey | QHLPGYRDADDUGY-FTJBHMTQSA-N |
| XLogP | 5.40 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|