C12H18OS — CID 102084882
(1R,6S,8R)-8-ethenyl-3,3,8-trimethyl-2-thiabicyclo[4.2.0]octan-5-one (PubChem CID 102084882) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is (1R,6S,8R)-8-ethenyl-3,3,8-trimethyl-2-thiabicyclo[4.2.0]octan-5-one.
| Compound Name | (1R,6S,8R)-8-ethenyl-3,3,8-trimethyl-2-thiabicyclo[4.2.0]octan-5-one |
|---|---|
| PubChem CID | 102084882 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (1R,6S,8R)-8-ethenyl-3,3,8-trimethyl-2-thiabicyclo[4.2.0]octan-5-one |
| SMILES | C=C[C@@]1(C)C[C@H]2C(=O)CC(C)(C)S[C@H]21 |
| InChI | InChI=1S/C12H18OS/c1-5-12(4)6-8-9(13)7-11(2,3)14-10(8)12/h5,8,10H,1,6-7H2,2-4H3/t8-,10+,12-/m0/s1 |
| InChIKey | LGPMKZVFLBFEAU-XRNSZHNASA-N |
| XLogP | 3.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|