C11H19NO — CID 102084980
(1R)-1-[(4S,5S)-6-azaspiro[4.5]dec-8-en-4-yl]ethanol (PubChem CID 102084980) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (1R)-1-[(4S,5S)-6-azaspiro[4.5]dec-8-en-4-yl]ethanol.
| Compound Name | (1R)-1-[(4S,5S)-6-azaspiro[4.5]dec-8-en-4-yl]ethanol |
|---|---|
| PubChem CID | 102084980 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (1R)-1-[(4S,5S)-6-azaspiro[4.5]dec-8-en-4-yl]ethanol |
| SMILES | C[C@@H](O)[C@H]1CCC[C@]12CC=CCN2 |
| InChI | InChI=1S/C11H19NO/c1-9(13)10-5-4-7-11(10)6-2-3-8-12-11/h2-3,9-10,12-13H,4-8H2,1H3/t9-,10-,11-/m1/s1 |
| InChIKey | KIOAUBMXLFIWPY-GMTAPVOTSA-N |
| XLogP | 1.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|