C11H17NO — CID 15173139
[(1R,2R,4R)-2-(prop-2-enylamino)-2-bicyclo[2.2.1]hept-5-enyl]methanol (PubChem CID 15173139) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is [(1R,2R,4R)-2-(prop-2-enylamino)-2-bicyclo[2.2.1]hept-5-enyl]methanol.
| Compound Name | [(1R,2R,4R)-2-(prop-2-enylamino)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
|---|---|
| PubChem CID | 15173139 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | [(1R,2R,4R)-2-(prop-2-enylamino)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| SMILES | C=CCN[C@]1(CO)C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C11H17NO/c1-2-5-12-11(8-13)7-9-3-4-10(11)6-9/h2-4,9-10,12-13H,1,5-8H2/t9-,10+,11+/m1/s1 |
| InChIKey | BTDTULODXKGPJV-VWYCJHECSA-N |
| XLogP | 1.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|