C24H40O4 — CID 102085318
(3Z,16E)-1,6-dioxacyclohexacosa-3,16-diene-2,5-dione (PubChem CID 102085318) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is (3Z,16E)-1,6-dioxacyclohexacosa-3,16-diene-2,5-dione.
| Compound Name | (3Z,16E)-1,6-dioxacyclohexacosa-3,16-diene-2,5-dione |
|---|---|
| PubChem CID | 102085318 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (3Z,16E)-1,6-dioxacyclohexacosa-3,16-diene-2,5-dione |
| SMILES | O=C1/C=C\C(=O)OCCCCCCCCC/C=C/CCCCCCCCCO1 |
| InChI | InChI=1S/C24H40O4/c25-23-19-20-24(26)28-22-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-21-27-23/h1-2,19-20H,3-18,21-22H2/b2-1+,20-19- |
| InChIKey | XDUGVPFXNOTPHS-VAXMLIIRSA-N |
| XLogP | 6.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|