C16H26N2 — CID 102086658
2-cyclopenta-1,3-dien-1-yl-1-octyl-4,5-dihydroimidazole (PubChem CID 102086658) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-1-octyl-4,5-dihydroimidazole.
| Compound Name | 2-cyclopenta-1,3-dien-1-yl-1-octyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 102086658 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-yl-1-octyl-4,5-dihydroimidazole |
| SMILES | CCCCCCCCN1CCN=C1C1=CC=CC1 |
| InChI | InChI=1S/C16H26N2/c1-2-3-4-5-6-9-13-18-14-12-17-16(18)15-10-7-8-11-15/h7-8,10H,2-6,9,11-14H2,1H3 |
| InChIKey | RMQYROHZOPHSJB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|