C7H13NO — CID 102087753
cis-(1S,2R)-2-methanimidoylcyclohexan-1-ol (PubChem CID 102087753) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is cis-(1S,2R)-2-methanimidoylcyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-methanimidoylcyclohexan-1-ol |
|---|---|
| PubChem CID | 102087753 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | cis-(1S,2R)-2-methanimidoylcyclohexan-1-ol |
| SMILES | [H]/N=C/[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C7H13NO/c8-5-6-3-1-2-4-7(6)9/h5-9H,1-4H2/b8-5+/t6-,7+/m1/s1 |
| InChIKey | NPJGJBFBTXLWDQ-YVQXEBPBSA-N |
| XLogP | 1.19 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|