C26H27N3O2 — CID 102088190
N-[1-[4-[[(3,5-dimethylphenyl)methylamino]methyl]phenyl]prop-2-ynyl]-2-methyl-4-nitroaniline (PubChem CID 102088190) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[1-[4-[[(3,5-dimethylphenyl)methylamino]methyl]phenyl]prop-2-ynyl]-2-methyl-4-nitroaniline.
| Compound Name | N-[1-[4-[[(3,5-dimethylphenyl)methylamino]methyl]phenyl]prop-2-ynyl]-2-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 102088190 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[1-[4-[[(3,5-dimethylphenyl)methylamino]methyl]phenyl]prop-2-ynyl]-2-methyl-4-nitroaniline |
| SMILES | C#CC(Nc1ccc([N+](=O)[O-])cc1C)c1ccc(CNCc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C26H27N3O2/c1-5-25(28-26-11-10-24(29(30)31)15-20(26)4)23-8-6-21(7-9-23)16-27-17-22-13-18(2)12-19(3)14-22/h1,6-15,25,27-28H,16-17H2,2-4H3 |
| InChIKey | APXYCARSGSMVOF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|