C16H18N2O2 — CID 61030106
N-[(3,5-dimethylphenyl)methyl]-1-(4-nitrophenyl)methanamine (PubChem CID 61030106) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-[(3,5-dimethylphenyl)methyl]-1-(4-nitrophenyl)methanamine.
| Compound Name | N-[(3,5-dimethylphenyl)methyl]-1-(4-nitrophenyl)methanamine |
|---|---|
| PubChem CID | 61030106 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-[(3,5-dimethylphenyl)methyl]-1-(4-nitrophenyl)methanamine |
| SMILES | Cc1cc(C)cc(CNCc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C16H18N2O2/c1-12-7-13(2)9-15(8-12)11-17-10-14-3-5-16(6-4-14)18(19)20/h3-9,17H,10-11H2,1-2H3 |
| InChIKey | ZLTRDRSTYVBFOX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|