C19H39BO3Si — CID 102088904
dimethyl-propan-2-yloxy-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-2-yl]silane (PubChem CID 102088904) has the molecular formula C19H39BO3Si and a molecular weight of 354.42 g/mol. Its IUPAC name is dimethyl-propan-2-yloxy-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-2-yl]silane.
| Compound Name | dimethyl-propan-2-yloxy-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-2-yl]silane |
|---|---|
| PubChem CID | 102088904 |
| Molecular Formula | C19H39BO3Si |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | dimethyl-propan-2-yloxy-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-1-en-2-yl]silane |
| SMILES | CCCCCC/C(=C\B1OC(C)(C)C(C)(C)O1)[Si](C)(C)OC(C)C |
| InChI | InChI=1S/C19H39BO3Si/c1-10-11-12-13-14-17(24(8,9)21-16(2)3)15-20-22-18(4,5)19(6,7)23-20/h15-16H,10-14H2,1-9H3/b17-15+ |
| InChIKey | IVTQEKFUCRACEG-BMRADRMJSA-N |
| XLogP | 5.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|