C17H35BO3Si — CID 101350027
tert-butyl-dimethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]silane (PubChem CID 101350027) has the molecular formula C17H35BO3Si and a molecular weight of 326.36 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]silane |
|---|---|
| PubChem CID | 101350027 |
| Molecular Formula | C17H35BO3Si |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | tert-butyl-dimethyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]silane |
| SMILES | C=C(CCCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H35BO3Si/c1-14(18-20-16(5,6)17(7,8)21-18)12-11-13-19-22(9,10)15(2,3)4/h1,11-13H2,2-10H3 |
| InChIKey | ZYUMWALPVFIXLW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|