C21H44BLiO3Si — CID 57332414
lithium tert-butyl-[(E)-5-(2-tert-butyl-4,4,5,5-tetramethyl-1,3-dioxa-2-boranuidacyclopent-2-yl)pent-4-enoxy]-dimethylsilane (PubChem CID 57332414) has the molecular formula C21H44BLiO3Si and a molecular weight of 390.42 g/mol. Its IUPAC name is lithium tert-butyl-[(E)-5-(2-tert-butyl-4,4,5,5-tetramethyl-1,3-dioxa-2-boranuidacyclopent-2-yl)pent-4-enoxy]-dimethylsilane.
| Compound Name | lithium tert-butyl-[(E)-5-(2-tert-butyl-4,4,5,5-tetramethyl-1,3-dioxa-2-boranuidacyclopent-2-yl)pent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 57332414 |
| Molecular Formula | C21H44BLiO3Si |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.33 |
| IUPAC Name | lithium tert-butyl-[(E)-5-(2-tert-butyl-4,4,5,5-tetramethyl-1,3-dioxa-2-boranuidacyclopent-2-yl)pent-4-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[B-]1(/C=C/CCCO[Si](C)(C)C(C)(C)C)OC(C)(C)C(C)(C)O1.[Li+] |
| InChI | InChI=1S/C21H44BO3Si.Li/c1-18(2,3)22(24-20(7,8)21(9,10)25-22)16-14-13-15-17-23-26(11,12)19(4,5)6;/h14,16H,13,15,17H2,1-12H3;/q-1;+1/b16-14+; |
| InChIKey | SBDKIXIHQFITRC-BACBYAOASA-N |
| XLogP | 3.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|