C19H40BClO3Si2 — CID 102111320
tert-butyl-[(E)-4-[chloro(dimethyl)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane (PubChem CID 102111320) has the molecular formula C19H40BClO3Si2 and a molecular weight of 418.96 g/mol. Its IUPAC name is tert-butyl-[(E)-4-[chloro(dimethyl)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-[chloro(dimethyl)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102111320 |
| Molecular Formula | C19H40BClO3Si2 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl-[(E)-4-[chloro(dimethyl)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-dimethylsilane |
| SMILES | CC1(C)OB(/C=C(\CCCO[Si](C)(C)C(C)(C)C)[Si](C)(C)Cl)OC1(C)C |
| InChI | InChI=1S/C19H40BClO3Si2/c1-17(2,3)26(10,11)22-14-12-13-16(25(8,9)21)15-20-23-18(4,5)19(6,7)24-20/h15H,12-14H2,1-11H3/b16-15+ |
| InChIKey | RNRRKEMIWOEFCU-FOCLMDBBSA-N |
| XLogP | 6.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|