C23H46B2O5Si — CID 16750756
[(3R)-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-tert-butyl-dimethylsilane (PubChem CID 16750756) has the molecular formula C23H46B2O5Si and a molecular weight of 452.33 g/mol. Its IUPAC name is [(3R)-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(3R)-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 16750756 |
| Molecular Formula | C23H46B2O5Si |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | [(3R)-3,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@@H](CCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H46B2O5Si/c1-17(24-27-20(5,6)21(7,8)28-24)18(15-16-26-31(13,14)19(2,3)4)25-29-22(9,10)23(11,12)30-25/h18H,1,15-16H2,2-14H3/t18-/m1/s1 |
| InChIKey | ZSOVHQFSZPTXAP-GOSISDBHSA-N |
| XLogP | 6.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|