C18H36B2O4Si — CID 54762385
[(Z)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-trimethylsilane (PubChem CID 54762385) has the molecular formula C18H36B2O4Si and a molecular weight of 366.19 g/mol. Its IUPAC name is [(Z)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-trimethylsilane.
| Compound Name | [(Z)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 54762385 |
| Molecular Formula | C18H36B2O4Si |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | [(Z)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]-trimethylsilane |
| SMILES | CC1(C)OB(/C=C(\C[Si](C)(C)C)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C18H36B2O4Si/c1-15(2)16(3,4)22-19(21-15)12-14(13-25(9,10)11)20-23-17(5,6)18(7,8)24-20/h12H,13H2,1-11H3/b14-12+ |
| InChIKey | GRRJHLBKPBVEGI-WYMLVPIESA-N |
| XLogP | 4.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|