C22H48B2O5Si2 — CID 154712243
[dimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silyl]oxy-dimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane (PubChem CID 154712243) has the molecular formula C22H48B2O5Si2 and a molecular weight of 470.42 g/mol. Its IUPAC name is [dimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silyl]oxy-dimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane.
| Compound Name | [dimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silyl]oxy-dimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane |
|---|---|
| PubChem CID | 154712243 |
| Molecular Formula | C22H48B2O5Si2 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | [dimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silyl]oxy-dimethyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane |
| SMILES | CC1(C)OB(CCC[Si](C)(C)O[Si](C)(C)CCCB2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C22H48B2O5Si2/c1-19(2)20(3,4)26-23(25-19)15-13-17-30(9,10)29-31(11,12)18-14-16-24-27-21(5,6)22(7,8)28-24/h13-18H2,1-12H3 |
| InChIKey | PMPKVVVXFRFEMR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|