C16H36B2O5Si2 — CID 102338502
[dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silyl]oxy-dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane (PubChem CID 102338502) has the molecular formula C16H36B2O5Si2 and a molecular weight of 386.26 g/mol. Its IUPAC name is [dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silyl]oxy-dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane.
| Compound Name | [dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silyl]oxy-dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
|---|---|
| PubChem CID | 102338502 |
| Molecular Formula | C16H36B2O5Si2 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silyl]oxy-dimethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
| SMILES | CC1(C)OB([Si](C)(C)O[Si](C)(C)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C16H36B2O5Si2/c1-13(2)14(3,4)20-17(19-13)24(9,10)23-25(11,12)18-21-15(5,6)16(7,8)22-18/h1-12H3 |
| InChIKey | WVWXRNYPZXCRDC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|