C22H42B2O4Si2 — CID 135049162
[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane (PubChem CID 135049162) has the molecular formula C22H42B2O4Si2 and a molecular weight of 448.37 g/mol. Its IUPAC name is [(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane.
| Compound Name | [(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 135049162 |
| Molecular Formula | C22H42B2O4Si2 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane |
| SMILES | CC1(C)OB(/C(C#C[Si](C)(C)C)=C(\B2OC(C)(C)C(C)(C)O2)[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C22H42B2O4Si2/c1-19(2)20(3,4)26-23(25-19)17(15-16-29(9,10)11)18(30(12,13)14)24-27-21(5,6)22(7,8)28-24/h1-14H3/b18-17+ |
| InChIKey | KPLAHCPAPLLPSL-ISLYRVAYSA-N |
| XLogP | 5.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|