C18H21N3O5 — CID 102089104
(2S)-2-[[(2R)-2-[[(2S)-2-acetamidopropanoyl]amino]but-3-ynoyl]amino]-3-phenylpropanoic acid (PubChem CID 102089104) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2S)-2-acetamidopropanoyl]amino]but-3-ynoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[(2S)-2-acetamidopropanoyl]amino]but-3-ynoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 102089104 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2S)-2-acetamidopropanoyl]amino]but-3-ynoyl]amino]-3-phenylpropanoic acid |
| SMILES | C#C[C@@H](NC(=O)[C@H](C)NC(C)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H21N3O5/c1-4-14(20-16(23)11(2)19-12(3)22)17(24)21-15(18(25)26)10-13-8-6-5-7-9-13/h1,5-9,11,14-15H,10H2,2-3H3,(H,19,22)(H,20,23)(H,21,24)(H,25,26)/t11-,14+,15-/m0/s1 |
| InChIKey | GUSFEUVMQKUHGO-GLQYFDAESA-N |
| XLogP | -0.56 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|