C56H50F6O3S2 — CID 102089152
4-pyren-1-ylbutyl 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-octoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]benzoate (PubChem CID 102089152) has the molecular formula C56H50F6O3S2 and a molecular weight of 949.13 g/mol. Its IUPAC name is 4-pyren-1-ylbutyl 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-octoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]benzoate.
| Compound Name | 4-pyren-1-ylbutyl 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-octoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]benzoate |
|---|---|
| PubChem CID | 102089152 |
| Molecular Formula | C56H50F6O3S2 |
| Molecular Weight | 949.13 g/mol |
| Exact Mass | 948.31 |
| IUPAC Name | 4-pyren-1-ylbutyl 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-octoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2cc(C3=C(c4cc(-c5ccc(C(=O)OCCCCc6ccc7ccc8cccc9ccc6c7c89)cc5)sc4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C56H50F6O3S2/c1-4-5-6-7-8-10-30-64-43-27-24-38(25-28-43)48-33-46(35(3)67-48)52-51(54(57,58)56(61,62)55(52,59)60)45-32-47(66-34(45)2)37-17-22-42(23-18-37)53(63)65-31-11-9-13-36-16-19-41-21-20-39-14-12-15-40-26-29-44(36)50(41)49(39)40/h12,14-29,32-33H,4-11,13,30-31H2,1-3H3 |
| InChIKey | ZCUIEIVVJWDXSB-UHFFFAOYSA-N |
| XLogP | 17.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.13 |
| LogP ≤ 5 | 17.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|